Compound Q&A

What are the main uses of 6-nitro-1H-indazole (CAS: 7597-18-4)?

Answer

6-nitro-1H-indazole
6-nitro-1H-indazole (CAS: 7597-18-4) is primarily used in pharmaceutical research as a key intermediate for developing drugs targeting inflammation and cancer. It also finds applications in industrial chemistry for producing dyes and materials, and in research for studying heterocyclic compounds. Its versatility in chemical reactivity makes it valuable in the synthesis of bioactive molecules and functional chemicals.

About

CAS No 7597-18-4
English Name 6-nitro-1H-indazole
Molecular Formula C7H5N3O2
Molecular Weight 163.13 g/mol
SMILES C1=CC2=C(C=C1[N+](=O)[O-])NN=C2
InChIKey ORZRMRUXSPNQQL-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 6-nitro-1H-indazole (CAS: 7597-18-4)?

6-nitro-1H-indazole (CAS: 7597-18-4) is a heterocyclic aromatic compound with the chemical formula C...

Compound Q&A

Is 6-nitro-1H-indazole (CAS: 7597-18-4) safe?

6-nitro-1H-indazole (CAS: 7597-18-4) is considered a hazardous substance due to its potential to cau...

Compound Q&A

How should 6-nitro-1H-indazole (CAS: 7597-18-4) be stored?

6-nitro-1H-indazole (CAS: 7597-18-4) should be stored in a sealed, airtight container in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...