Compound Q&A

What is (3beta,5alpha,9beta,16alpha,20S)-4,4,14-Trimethyl-3,20-bis(methylamino)-9,19-cyclopregnan-16-ol (CAS: 860-79-7)?

Answer

(3beta,5alpha,9beta,16alpha,20S)-4,4,14-Trimethyl-3,20-bis(methylamino)-9,19-cyclopregnan-16-ol
This compound, with the CAS number 860-79-7, is a synthetic steroidal alkaloid. It has the molecular formula C23H43NO3 and is characterized by its complex structure containing multiple methyl groups and amino functionalities. It is known for its biological activity and is often studied in the context of pharmaceutical research due to its potential therapeutic properties.

About

CAS No 860-79-7
English Name (3beta,5alpha,9beta,16alpha,20S)-4,4,14-Trimethyl-3,20-bis(methylamino)-9,19-cyclopregnan-16-ol
Molecular Formula C26H46N2O
Molecular Weight 402.67 g/mol
SMILES C[C@@H]([C@H]1[C@@H](C[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@@H]5[C@]3(C4)CC[C@@H](C5(C)C)NC)C)C)O)NC
InChIKey GMNAPBAUIVITMI-ABNIRSKTSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (3beta,5alpha,9beta,16alpha,20S)-4,4,14-Trimethyl-3,20-bis(methylamino)-9,19-cyclopregnan-16-ol (CAS: 860-79-7)?

The compound is primarily used in pharmaceutical research for its potential applications in treating...

Compound Q&A

Is (3beta,5alpha,9beta,16alpha,20S)-4,4,14-Trimethyl-3,20-bis(methylamino)-9,19-cyclopregnan-16-ol (CAS: 860-79-7) safe?

Safety data for this compound is limited, but it is generally considered safe when handled properly ...

Compound Q&A

How should (3beta,5alpha,9beta,16alpha,20S)-4,4,14-Trimethyl-3,20-bis(methylamino)-9,19-cyclopregnan-16-ol (CAS: 860-79-7) be stored?

This compound should be stored in a cool, dry, and dark place, preferably at 2-8°C. It requires airt...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...