Compound Q&A

What is Clopidogrel EP Impurity F HCl (CAS: 141109-19-5)?

Answer

Clopidogrel EP Impurity F HCl
Clopidogrel EP Impurity F HCl (CAS: 141109-19-5) is a hydrochloride salt form of an impurity associated with the pharmaceutical compound clopidogrel. It is commonly used as a reference standard in quality control testing to identify and quantify trace impurities during drug development. Its molecular structure is related to clopidogrel but includes specific modifications, making it relevant for analytical chemistry and regulatory compliance.

About

English Name Clopidogrel EP Impurity F HCl
Molecular Formula C15H17Cl2NO2S
Molecular Weight 346.28 g/mol
SMILES COC(=O)C(C1=CC=CC=C1Cl)NCCC2=CC=CS2.Cl
InChIKey ZXANKCFSGFEBQW-UQKRIMTDSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Clopidogrel EP Impurity F HCl (CAS: 141109-19-5)?

Clopidogrel EP Impurity F HCl (CAS: 141109-19-5) is primarily used in pharmaceutical research and qu...

Compound Q&A

Is Clopidogrel EP Impurity F HCl (CAS: 141109-19-5) safe?

Clopidogrel EP Impurity F HCl (CAS: 141109-19-5) is generally considered safe when handled properly,...

Compound Q&A

How should Clopidogrel EP Impurity F HCl (CAS: 141109-19-5) be stored?

Clopidogrel EP Impurity F HCl (CAS: 141109-19-5) should be stored in a cool, dry place, away from di...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...