Compound Q&A

What are the main uses of 2,6-Dichloronicotinic acid (CAS: 38496-18-3)?

Answer

2,6-Dichloronicotinic acid
2,6-Dichloronicotinic acid (CAS: 38496-18-3) is primarily used in pharmaceutical research as a precursor for drug development. It also finds applications in organic synthesis, particularly in the production of agrochemicals and specialty chemicals. Additionally, it is used in the synthesis of various derivatives that are relevant in medicinal chemistry and industrial processes.

About

CAS No 38496-18-3
English Name 2,6-Dichloronicotinic acid
Molecular Formula C6H3Cl2NO2
Molecular Weight 192 g/mol
SMILES C1=CC(=NC(=C1C(=O)O)Cl)Cl
InChIKey AJPKQSSFYHPYMH-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2,6-Dichloronicotinic acid (CAS: 38496-18-3)?

2,6-Dichloronicotinic acid (CAS: 38496-18-3) is a chlorinated derivative of nicotinic acid. It has t...

Compound Q&A

Is 2,6-Dichloronicotinic acid (CAS: 38496-18-3) safe?

2,6-Dichloronicotinic acid (CAS: 38496-18-3) is considered toxic upon ingestion or inhalation. It sh...

Compound Q&A

How should 2,6-Dichloronicotinic acid (CAS: 38496-18-3) be stored?

2,6-Dichloronicotinic acid (CAS: 38496-18-3) should be stored in a cool, dry, and dark place, away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...