Compound Q&A

What is Methyl 2-({[(4,6-dimethoxy-2-pyrimidinyl)carbamoyl]sulfamoyl}methyl)benzoate (CAS: 83055-99-6)?

Answer

Methyl 2-({[(4,6-dimethoxy-2-pyrimidinyl)carbamoyl]sulfamoyl}methyl)benzoate
Methyl 2-({[(4,6-dimethoxy-2-pyrimidinyl)carbamoyl]sulfamoyl}methyl)benzoate is a chemical compound with the CAS number 83055-99-6. It is a derivative of benzoic acid, featuring a complex structure with a sulfamoyl group and a carbamoyl group attached to a pyrimidine ring. This compound is known for its potential applications in medicinal chemistry and is often used as an intermediate in the synthesis of pharmaceuticals.

About

CAS No 83055-99-6
English Name Methyl 2-({[(4,6-dimethoxy-2-pyrimidinyl)carbamoyl]sulfamoyl}methyl)benzoate
Molecular Formula C16H18N4O7S
Molecular Weight 410.41 g/mol
SMILES COc1cc(nc(n1)NC(=O)NS(=O)(=O)Cc2ccccc2C(=O)OC)OC
InChIKey XMQFTWRPUQYINF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Methyl 2-({[(4,6-dimethoxy-2-pyrimidinyl)carbamoyl]sulfamoyl}methyl)benzoate (CAS: 83055-99-6)?

Methyl 2-({[(4,6-dimethoxy-2-pyrimidinyl)carbamoyl]sulfamoyl}methyl)benzoate is primarily used in ph...

Compound Q&A

Is Methyl 2-({[(4,6-dimethoxy-2-pyrimidinyl)carbamoyl]sulfamoyl}methyl)benzoate (CAS: 83055-99-6) safe?

The safety of Methyl 2-({[(4,6-dimethoxy-2-pyrimidinyl)carbamoyl]sulfamoyl}methyl)benzoate depends o...

Compound Q&A

How should Methyl 2-({[(4,6-dimethoxy-2-pyrimidinyl)carbamoyl]sulfamoyl}methyl)benzoate (CAS: 83055-99-6) be stored?

Methyl 2-({[(4,6-dimethoxy-2-pyrimidinyl)carbamoyl]sulfamoyl}methyl)benzoate should be stored in a c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...