Compound Q&A

What are the main uses of 2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid (CAS: 65-86-1)?

Answer

2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid
2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid (CAS: 65-86-1) is primarily used in pharmaceutical research as a building block for synthesizing antiviral drugs like acyclovir. It also finds applications in the production of dyes, pesticides, and other organic compounds. In industrial settings, it serves as a precursor for various chemical derivatives and functional materials.

About

CAS No 65-86-1
English Name 2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid
Molecular Formula C5H4N2O4
Molecular Weight 156.1 g/mol
SMILES OC(=O)c1cc(=O)[nH]c(=O)[nH]1
InChIKey PXQPEWDEAKTCGB-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid (CAS: 65-86-1)?

2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid (CAS: 65-86-1) is a pyrimidine derivative w...

Compound Q&A

Is 2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid (CAS: 65-86-1) safe?

2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid (CAS: 65-86-1) requires careful handling du...

Compound Q&A

How should 2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid (CAS: 65-86-1) be stored?

2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid (CAS: 65-86-1) should be stored in a cool, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...