Compound Q&A

What are the main uses of Tris(4-methoxyphenyl)phosphine (CAS: 855-38-9)?

Answer

Tris(4-methoxyphenyl)phosphine
Tris(4-methoxyphenyl)phosphine is primarily used in pharmaceutical research as a phosphine ligand for metal complexes involved in drug development. It also finds applications in organic synthesis and catalytic processes. Additionally, it is used in the production of certain specialty chemicals and materials due to its reactivity and functional group versatility.

About

CAS No 855-38-9
English Name Tris(4-methoxyphenyl)phosphine
Molecular Formula C21H21O3P
Molecular Weight 352.37 g/mol
SMILES COc1ccc(cc1)P(c2ccc(OC)cc2)c3ccc(OC)cc3
InChIKey UYUUAUOYLFIRJG-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Tris(4-methoxyphenyl)phosphine (CAS: 855-38-9)?

Tris(4-methoxyphenyl)phosphine is an organic phosphine compound with the chemical formula C18H18O3P....

Compound Q&A

Is Tris(4-methoxyphenyl)phosphine (CAS: 855-38-9) safe?

Tris(4-methoxyphenyl)phosphine is generally considered safe when handled properly. However, it shoul...

Compound Q&A

How should Tris(4-methoxyphenyl)phosphine (CAS: 855-38-9) be stored?

Tris(4-methoxyphenyl)phosphine should be stored in a cool, dry, and well-ventilated area, away from ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...