Compound Q&A

What is (2E,2'E,2''E)-N,N',N''-[(Methylsilanetriyl)tris(oxy)]tri(2-butanimine) (CAS: 22984-54-9)?

Answer

(2E,2'E,2''E)-N,N',N''-[(Methylsilanetriyl)tris(oxy)]tri(2-butanimine)
The compound (2E,2'E,2''E)-N,N',N''-[(Methylsilanetriyl)tris(oxy)]tri(2-butanimine), with CAS number 22984-54-9, is a complex organic silane-based molecule. It contains three 2-butanimine groups connected via a methylsilanetriyl tris(oxy) bridge, forming a triamine structure. This compound is known for its stability and is often used in specialized chemical applications due to its unique molecular architecture.

About

CAS No 22984-54-9
English Name (2E,2'E,2''E)-N,N',N''-[(Methylsilanetriyl)tris(oxy)]tri(2-butanimine)
Molecular Formula C13H27N3O3Si
Molecular Weight 301.46 g/mol
SMILES CCC(=NO[Si](C)(ON=C(C)CC)ON=C(C)CC)C
InChIKey OGZPYBBKQGPQNU-DABLZPOSSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (2E,2'E,2''E)-N,N',N''-[(Methylsilanetriyl)tris(oxy)]tri(2-butanimine) (CAS: 22984-54-9)?

This compound is primarily used in pharmaceutical research for its potential as a linker or scaffold...

Compound Q&A

Is (2E,2'E,2''E)-N,N',N''-[(Methylsilanetriyl)tris(oxy)]tri(2-butanimine) (CAS: 22984-54-9) safe?

Safety of (2E,2'E,2''E)-N,N',N''-[(Methylsilanetriyl)tris(oxy)]tri(2-butanimine) depends on its hand...

Compound Q&A

How should (2E,2'E,2''E)-N,N',N''-[(Methylsilanetriyl)tris(oxy)]tri(2-butanimine) (CAS: 22984-54-9) be stored?

The compound should be stored in a cool, dry, and well-ventilated area, away from direct light. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...