Compound Q&A

What is Methyl (2E)-(methoxyimino){2-[(2-methylphenoxy)methyl]phenyl}acetate (CAS: 143390-89-0)?

Answer

Methyl (2E)-(methoxyimino){2-[(2-methylphenoxy)methyl]phenyl}acetate
Methyl (2E)-(methoxyimino){2-[(2-methylphenoxy)methyl]phenyl}acetate is an organic compound with the CAS number 143390-89-0. It is a derivative of acetate featuring a methoxyimino group and a substituted phenyl ring. The compound is known for its stability in organic solvents and is often used in chemical synthesis. Its molecular structure includes a methoxyimino linkage and a methylene bridge connecting two phenyl groups, making it a versatile intermediate in pharmaceutical and industrial applications.

About

English Name Methyl (2E)-(methoxyimino){2-[(2-methylphenoxy)methyl]phenyl}acetate
Molecular Formula C18H19NO4
Molecular Weight 313.35 g/mol
SMILES O=C(OC)/C(C1=CC=CC=C1COC2=CC=CC=C2C)=N/OC
InChIKey ZOTBXTZVPHCKPN-HTXNQAPBSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Methyl (2E)-(methoxyimino){2-[(2-methylphenoxy)methyl]phenyl}acetate (CAS: 143390-89-0)?

Methyl (2E)-(methoxyimino){2-[(2-methylphenoxy)methyl]phenyl}acetate is primarily used in pharmaceut...

Compound Q&A

Is Methyl (2E)-(methoxyimino){2-[(2-methylphenoxy)methyl]phenyl}acetate (CAS: 143390-89-0) safe?

Methyl (2E)-(methoxyimino){2-[(2-methylphenoxy)methyl]phenyl}acetate is generally considered safe wh...

Compound Q&A

How should Methyl (2E)-(methoxyimino){2-[(2-methylphenoxy)methyl]phenyl}acetate (CAS: 143390-89-0) be stored?

Methyl (2E)-(methoxyimino){2-[(2-methylphenoxy)methyl]phenyl}acetate should be stored in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...