Compound Q&A

What is 1-(3-Nitrophenyl)ethanone (CAS: 121-89-1)?

Answer

1-(3-Nitrophenyl)ethanone
1-(3-Nitrophenyl)ethanone, with the CAS number 121-89-1, is an organic compound featuring a ketone group attached to a 3-nitrophenyl ring. It has the molecular formula C9H8NO3 and is typically a yellowish solid with a molecular weight of 168.16 g/mol. This compound is known for its aromatic structure and is commonly used in chemical synthesis due to its reactivity and versatility.

About

CAS No 121-89-1
English Name 1-(3-Nitrophenyl)ethanone
Molecular Formula C8H7NO3
Molecular Weight 165.15 g/mol
SMILES CC(=O)C1=CC(=CC=C1)[N+](=O)[O-]
InChIKey ARKIFHPFTHVKDT-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 1-(3-Nitrophenyl)ethanone (CAS: 121-89-1)?

1-(3-Nitrophenyl)ethanone (CAS: 121-89-1) is widely used in pharmaceutical research as a key interme...

Compound Q&A

Is 1-(3-Nitrophenyl)ethanone (CAS: 121-89-1) safe?

1-(3-Nitrophenyl)ethanone (CAS: 121-89-1) is generally considered safe when handled properly. Howeve...

Compound Q&A

How should 1-(3-Nitrophenyl)ethanone (CAS: 121-89-1) be stored?

1-(3-Nitrophenyl)ethanone (CAS: 121-89-1) should be stored in a cool, dry, and well-ventilated place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...