Compound Q&A

How should 2-Methyl-3-nitrobenzoic acid (CAS: 1975-50-4) be stored?

Answer

2-Methyl-3-nitrobenzoic acid
2-Methyl-3-nitrobenzoic acid (CAS: 1975-50-4) should be stored in a cool, dry, and dark place, preferably at 25°C. It requires a sealed container to prevent moisture absorption and degradation. Avoid exposure to heat and incompatible materials. Store in a well-ventilated area to maintain stability and ensure safety compliance.

About

CAS No 1975-50-4
English Name 2-Methyl-3-nitrobenzoic acid
Molecular Formula C8H7NO4
Molecular Weight 181.15 g/mol
SMILES CC1=C(C=CC=C1[N+](=O)[O-])C(=O)O
InChIKey YPQAFWHSMWWPLX-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-Methyl-3-nitrobenzoic acid (CAS: 1975-50-4)?

2-Methyl-3-nitrobenzoic acid (CAS: 1975-50-4) is an organic compound with the chemical formula C7H6N...

Compound Q&A

What are the main uses of 2-Methyl-3-nitrobenzoic acid (CAS: 1975-50-4)?

2-Methyl-3-nitrobenzoic acid (CAS: 1975-50-4) is primarily used as a pharmaceutical intermediate, in...

Compound Q&A

Is 2-Methyl-3-nitrobenzoic acid (CAS: 1975-50-4) safe?

2-Methyl-3-nitrobenzoic acid (CAS: 1975-50-4) requires careful handling due to its potential toxicit...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...