Compound Q&A

How should 1,5-Naphthalenedisulfonic acid (CAS: 81-04-9) be stored?

Answer

1,5-Naphthalenedisulfonic acid
1,5-Naphthalenedisulfonic acid (CAS: 81-04-9) should be stored in a cool, dry, and well-ventilated area, away from light. It is best kept in a sealed container made of material resistant to chemical reactions, such as glass or polyethylene. Avoid exposure to moisture and ensure storage conditions maintain its stability and prevent degradation.

About

CAS No 81-04-9
English Name 1,5-Naphthalenedisulfonic acid
Molecular Formula C10H8O6S2
Molecular Weight 288.3 g/mol
SMILES C1=CC2=C(C=CC=C2S(=O)(=O)O)C(=C1)S(=O)(=O)O
InChIKey XTEGVFVZDVNBPF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 1,5-Naphthalenedisulfonic acid (CAS: 81-04-9)?

1,5-Naphthalenedisulfonic acid (CAS: 81-04-9) is an organic compound with the chemical formula C10H8...

Compound Q&A

What are the main uses of 1,5-Naphthalenedisulfonic acid (CAS: 81-04-9)?

1,5-Naphthalenedisulfonic acid (CAS: 81-04-9) is primarily used in the production of azo dyes and pi...

Compound Q&A

Is 1,5-Naphthalenedisulfonic acid (CAS: 81-04-9) safe?

1,5-Naphthalenedisulfonic acid (CAS: 81-04-9) is generally considered safe when handled properly. Ho...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...