Compound Q&A

How should 2,4-Pentanedione, ion(1-), calcium (CAS: 19372-44-2) be stored?

Answer

2,4-Pentanedione, ion(1-), calcium
2,4-Pentanedione, ion(1-), calcium should be stored in a cool, dry, and well-ventilated area away from moisture and light. It is best kept in a sealed container to maintain stability and prevent contamination. Storage conditions should be controlled to ensure the compound remains in a solid form and retains its chemical properties. The CAS number for this compound is 19372-44-2.

About

CAS No 19372-44-2
English Name 2,4-Pentanedione, ion(1-), calcium
Molecular Formula C10H14CaO4
Molecular Weight 238.29 g/mol
SMILES [O-]/C(=C\C(=O)C)/C.[O-]/C(=C\C(=O)C)/C.[Ca+2]
InChIKey FTDUGYDPOWCKTD-VGKOASNMSA-L
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2,4-Pentanedione, ion(1-), calcium (CAS: 19372-44-2)?

2,4-Pentanedione, ion(1-), calcium is a calcium salt of 2,4-pentanedione, a compound with the chemic...

Compound Q&A

What are the main uses of 2,4-Pentanedione, ion(1-), calcium (CAS: 19372-44-2)?

2,4-Pentanedione, ion(1-), calcium is primarily used as a chelating agent in various applications, i...

Compound Q&A

Is 2,4-Pentanedione, ion(1-), calcium (CAS: 19372-44-2) safe?

2,4-Pentanedione, ion(1-), calcium is generally considered safe when handled properly. However, it s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...