Compound Q&A

What are the main uses of (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-7-methoxy-6-quinazolinyl}-4-(1-piperidinyl)-2-butenamide (CAS: 1110813-31-4)?

Answer

(2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-7-methoxy-6-quinazolinyl}-4-(1-piperidinyl)-2-butenamide
The compound is mainly used in pharmaceutical development as a potential inhibitor for enzymes or receptors, particularly in medicinal chemistry for drug discovery. It may serve as an intermediate in synthesizing therapeutic agents targeting neurological disorders or cancer-related pathways. Additionally, it is explored in research for its chemical properties and applications in chemical synthesis.

About

English Name (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-7-methoxy-6-quinazolinyl}-4-(1-piperidinyl)-2-butenamide
Molecular Formula C24H25ClFN5O2
Molecular Weight 469.95 g/mol
SMILES COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)/C=C/CN4CCCCC4
InChIKey LVXJQMNHJWSHET-AATRIKPKSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-7-methoxy-6-quinazolinyl}-4-(1-piperidinyl)-2-butenamide (CAS: 1110813-31-4)?

This compound is a synthetic organic molecule with the CAS number 1110813-31-4. It contains a quinaz...

Compound Q&A

Is (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-7-methoxy-6-quinazolinyl}-4-(1-piperidinyl)-2-butenamide (CAS: 1110813-31-4) safe?

Safety of this compound requires adherence to standard chemical handling protocols. While specific t...

Compound Q&A

How should (2E)-N-{4-[(3-Chloro-4-fluorophenyl)amino]-7-methoxy-6-quinazolinyl}-4-(1-piperidinyl)-2-butenamide (CAS: 1110813-31-4) be stored?

Store this compound in a cool, dry place (ideally below 25°C), away from direct light. Use airtight,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...