Compound Q&A

What is 2,2'-[(2-Amino-2-oxoethyl)imino]diacetic acid (CAS: 26239-55-4)?

Answer

2,2'-[(2-Amino-2-oxoethyl)imino]diacetic acid
2,2'-[(2-Amino-2-oxoethyl)imino]diacetic acid (CAS: 26239-55-4) is a synthetic chelating agent with the chemical formula C8H14N2O6. It features two carboxylic acid groups connected by an imino bridge containing an amino and oxoethyl functional group. This compound is known for its ability to bind metal ions, making it valuable in various chemical applications. Its structure also includes a cyclic amide, contributing to its stability and reactivity in aqueous environments.

About

CAS No 26239-55-4
English Name 2,2'-[(2-Amino-2-oxoethyl)imino]diacetic acid
Molecular Formula C6H10N2O5
Molecular Weight 190.15 g/mol
SMILES C(C(=O)N)N(CC(=O)O)CC(=O)O
InChIKey QZTKDVCDBIDYMD-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2,2'-[(2-Amino-2-oxoethyl)imino]diacetic acid (CAS: 26239-55-4)?

2,2'-[(2-Amino-2-oxoethyl)imino]diacetic acid (CAS: 26239-55-4) is widely used in pharmaceuticals as...

Compound Q&A

Is 2,2'-[(2-Amino-2-oxoethyl)imino]diacetic acid (CAS: 26239-55-4) safe?

2,2'-[(2-Amino-2-oxoethyl)imino]diacetic acid (CAS: 26239-55-4) is generally considered safe when ha...

Compound Q&A

How should 2,2'-[(2-Amino-2-oxoethyl)imino]diacetic acid (CAS: 26239-55-4) be stored?

2,2'-[(2-Amino-2-oxoethyl)imino]diacetic acid (CAS: 26239-55-4) should be stored in a cool (25°C), d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...