Compound Q&A

What is 2-Hydroxy-4-(trifluoromethyl)benzoic acid (CAS: 328-90-5)?

Answer

2-Hydroxy-4-(trifluoromethyl)benzoic acid
2-Hydroxy-4-(trifluoromethyl)benzoic acid (CAS: 328-90-5) is an organic compound with the molecular formula C8H6F3O2. It is a white crystalline solid with strong acidic properties due to the carboxylic acid group. The trifluoromethyl group enhances its stability and reactivity, making it a valuable intermediate in various chemical syntheses.

About

CAS No 328-90-5
English Name 2-Hydroxy-4-(trifluoromethyl)benzoic acid
Molecular Formula C8H5F3O3
Molecular Weight 206.12 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)O)C(=O)O
InChIKey XMLFPUBZFSJWCN-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2-Hydroxy-4-(trifluoromethyl)benzoic acid (CAS: 328-90-5)?

2-Hydroxy-4-(trifluoromethyl)benzoic acid (CAS: 328-90-5) is primarily used in the pharmaceutical in...

Compound Q&A

Is 2-Hydroxy-4-(trifluoromethyl)benzoic acid (CAS: 328-90-5) safe?

2-Hydroxy-4-(trifluoromethyl)benzoic acid (CAS: 328-90-5) is generally considered safe when handled ...

Compound Q&A

How should 2-Hydroxy-4-(trifluoromethyl)benzoic acid (CAS: 328-90-5) be stored?

2-Hydroxy-4-(trifluoromethyl)benzoic acid (CAS: 328-90-5) should be stored in a cool, dry, and dark ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...