Compound Q&A

What are the main uses of 3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 461-05-2)?

Answer

3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride
3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 461-05-2) is primarily used in pharmaceuticals as a buffering agent and in organic synthesis as a versatile intermediate. It also finds applications in industrial processes, food additives, and research for its ability to stabilize reactions and maintain pH levels.

About

CAS No 461-05-2
English Name 3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride
Molecular Formula C7H16ClNO3
Molecular Weight 197.66 g/mol
SMILES C[N+](C)(C)CC(CC(=O)O)O.[Cl-]
InChIKey JXXCENBLGFBQJM-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 461-05-2)?

3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 461-05-2) is a quaternary ammoniu...

Compound Q&A

Is 3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 461-05-2) safe?

3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 461-05-2) is generally considered...

Compound Q&A

How should 3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 461-05-2) be stored?

3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 461-05-2) should be stored in a c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...