Compound Q&A

What is 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium methyl sulfate (CAS: 51-60-5)?

Answer

3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium methyl sulfate
3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium methyl sulfate (CAS: 51-60-5) is a quaternary ammonium compound with a complex structure. It is a white crystalline solid, typically soluble in water and polar organic solvents. This compound is known for its surfactant properties and is used in various chemical applications due to its ability to interact with both hydrophilic and hydrophobic substances.

About

CAS No 51-60-5
English Name 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium methyl sulfate
Molecular Formula C13H22N2O6S
Molecular Weight 334.39 g/mol
SMILES CN(C)C(=O)OC1=CC=CC(=C1)[N+](C)(C)C.COS(=O)(=O)[O-]
InChIKey OSZNNLWOYWAHSS-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium methyl sulfate (CAS: 51-60-5)?

3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium methyl sulfate (CAS: 51-60-5) is primarily used ...

Compound Q&A

Is 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium methyl sulfate (CAS: 51-60-5) safe?

3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium methyl sulfate (CAS: 51-60-5) is considered safe...

Compound Q&A

How should 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium methyl sulfate (CAS: 51-60-5) be stored?

3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium methyl sulfate (CAS: 51-60-5) should be stored i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...