Compound Q&A

What is Ginsenoside B2 (CAS: 52286-59-6)?

Answer

Ginsenoside B2
Ginsenoside B2 is a natural compound derived from ginseng, specifically Panax ginseng. It has the chemical formula C53H92O21 and is known for its triterpene saponin structure. This compound exhibits various biological activities, including anti-inflammatory and antioxidant properties, and is commonly studied for its potential health benefits.

About

CAS No 52286-59-6
English Name Ginsenoside B2
Molecular Formula C48H82O18
Molecular Weight 947.15 g/mol
SMILES CC1C(C(C(C(O1)OC2C(C(C(OC2OC3CC4(C(CC(C5C4(CCC5C(C)(CCC=C(C)C)OC6C(C(C(C(O6)CO)O)O)O)C)O)C7(C3C(C(CC7)O)(C)C)C)C)CO)O)O)O)O)O
InChIKey PWAOOJDMFUQOKB-WCZZMFLVSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Ginsenoside B2 (CAS: 52286-59-6)?

Ginsenoside B2 is primarily used in pharmaceutical research for its potential therapeutic effects. I...

Compound Q&A

Is Ginsenoside B2 (CAS: 52286-59-6) safe?

Ginsenoside B2 is generally considered safe when used in recommended amounts. However, like other gi...

Compound Q&A

How should Ginsenoside B2 (CAS: 52286-59-6) be stored?

Ginsenoside B2 should be stored in a cool, dry, and dark place to maintain its stability and potency...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...