Compound Q&A

What are the main uses of (2Z,4E)-5-(1-Hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl)-3-methyl-2,4-pentadienoic acid (CAS: 14375-45-2)?

Answer

(2Z,4E)-5-(1-Hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl)-3-methyl-2,4-pentadienoic acid
This compound is primarily used in pharmaceutical research for its potential biological activities, such as anti-inflammatory and antioxidant properties. It also finds application in organic synthesis as a building block for more complex molecules. Additionally, it is studied in chemical research for its structural features and reactivity in various reaction mechanisms, making it relevant in the development of new drugs and materials.

About

CAS No 14375-45-2
English Name (2Z,4E)-5-(1-Hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl)-3-methyl-2,4-pentadienoic acid
Molecular Formula C15H20O4
Molecular Weight 264.32 g/mol
SMILES CC1=CC(=O)CC(C1(C=CC(=CC(=O)O)C)O)(C)C
InChIKey JLIDBLDQVAYHNE-LXGGSRJLSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2Z,4E)-5-(1-Hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl)-3-methyl-2,4-pentadienoic acid (CAS: 14375-45-2)?

This compound, with the CAS number 14375-45-2, is a complex organic molecule characterized by a conj...

Compound Q&A

Is (2Z,4E)-5-(1-Hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl)-3-methyl-2,4-pentadienoic acid (CAS: 14375-45-2) safe?

The safety of this compound depends on its handling and exposure conditions. It is generally conside...

Compound Q&A

How should (2Z,4E)-5-(1-Hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl)-3-methyl-2,4-pentadienoic acid (CAS: 14375-45-2) be stored?

This compound should be stored in a cool, dry, and dark place to maintain stability. It is best kept...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...