Compound Q&A

What is 4-O-alpha-D-Glucopyranosyl-beta-D-glucopyranose (CAS: 69-79-4)?

Answer

4-O-alpha-D-Glucopyranosyl-beta-D-glucopyranose
4-O-alpha-D-Glucopyranosyl-beta-D-glucopyranose (CAS: 69-79-4) is a disaccharide sugar compound composed of two glucose units. It has the chemical formula C12H22O11 and is a white, crystalline solid with high water solubility. This compound is naturally found in plant cell walls and is known for its structural role in polysaccharides. Its glycosidic bond configuration contributes to its unique chemical properties and biological significance.

About

CAS No 69-79-4
English Name 4-O-alpha-D-Glucopyranosyl-beta-D-glucopyranose
Molecular Formula C12H22O11
Molecular Weight 342.3 g/mol
SMILES OC[C@@H](O)[C@@H](O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@@H](O)C=O
InChIKey GUBGYTABKSRVRQ-QUYVBRFLSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 4-O-alpha-D-Glucopyranosyl-beta-D-glucopyranose (CAS: 69-79-4)?

4-O-alpha-D-Glucopyranosyl-beta-D-glucopyranose (CAS: 69-79-4), also known as laminaribiose, is prim...

Compound Q&A

Is 4-O-alpha-D-Glucopyranosyl-beta-D-glucopyranose (CAS: 69-79-4) safe?

4-O-alpha-D-Glucopyranosyl-beta-D-glucopyranose (CAS: 69-79-4) is generally considered safe when use...

Compound Q&A

How should 4-O-alpha-D-Glucopyranosyl-beta-D-glucopyranose (CAS: 69-79-4) be stored?

4-O-alpha-D-Glucopyranosyl-beta-D-glucopyranose (CAS: 69-79-4) should be stored in a cool, dry, and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...