Compound Q&A

What are the main uses of (1R,2S,5R)-2-Isopropyl-5-methylcyclohexanol (CAS: 1490-04-6)?

Answer

(1R,2S,5R)-2-Isopropyl-5-methylcyclohexanol
(1R,2S,5R)-2-Isopropyl-5-methylcyclohexanol (CAS: 1490-04-6) is primarily utilized in pharmaceutical research for synthesizing bioactive compounds. It also serves as an industrial chemical in the production of fragrances and solvents. Additionally, it is employed in organic chemistry as a building block for complex molecules and specialty chemicals, including potential applications in drug development.

About

CAS No 1490-04-6
English Name (1R,2S,5R)-2-Isopropyl-5-methylcyclohexanol
Molecular Formula C10H20O
Molecular Weight 156.27 g/mol
SMILES C[C@@H]1CC[C@H]([C@@H](C1)O)C(C)C
InChIKey NOOLISFMXDJSKH-KXUCPTDWSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (1R,2S,5R)-2-Isopropyl-5-methylcyclohexanol (CAS: 1490-04-6)?

(1R,2S,5R)-2-Isopropyl-5-methylcyclohexanol (CAS: 1490-04-6) is a cyclic alcohol with the chemical f...

Compound Q&A

Is (1R,2S,5R)-2-Isopropyl-5-methylcyclohexanol (CAS: 1490-04-6) safe?

(1R,2S,5R)-2-Isopropyl-5-methylcyclohexanol (CAS: 1490-04-6) is generally considered safe when handl...

Compound Q&A

How should (1R,2S,5R)-2-Isopropyl-5-methylcyclohexanol (CAS: 1490-04-6) be stored?

(1R,2S,5R)-2-Isopropyl-5-methylcyclohexanol (CAS: 1490-04-6) should be stored in a cool, dry, and we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...