Compound Q&A

What is 4-Aminobenzamidine Dihydrochloride (CAS: 2498-50-2)?

Answer

4-Aminobenzamidine Dihydrochloride
4-Aminobenzamidine Dihydrochloride (CAS: 2498-50-2) is a chemical compound with the molecular formula C6H8N4Cl2. It is a white crystalline solid commonly used in pharmaceutical and biochemical applications. The compound is known for its ability to inhibit certain enzymes, making it valuable in drug development and research. It is also used as a synthetic intermediate in organic chemistry.

About

CAS No 2498-50-2
English Name 4-Aminobenzamidine Dihydrochloride
Molecular Formula C7H11Cl2N3
Molecular Weight 208.09 g/mol
SMILES C1=CC(=CC=C1C(=N)N)N.Cl.Cl
InChIKey GHEHNICLPWTXJC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 4-Aminobenzamidine Dihydrochloride (CAS: 2498-50-2)?

4-Aminobenzamidine Dihydrochloride (CAS: 2498-50-2) is primarily used in pharmaceuticals as an inhib...

Compound Q&A

Is 4-Aminobenzamidine Dihydrochloride (CAS: 2498-50-2) safe?

4-Aminobenzamidine Dihydrochloride (CAS: 2498-50-2) is generally considered safe when handled proper...

Compound Q&A

How should 4-Aminobenzamidine Dihydrochloride (CAS: 2498-50-2) be stored?

4-Aminobenzamidine Dihydrochloride (CAS: 2498-50-2) should be stored in a cool, dry, and well-ventil...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...