Compound Q&A

What are the main uses of Etidronic acid disodium (CAS: 7414-83-7)?

Answer

Etidronic acid disodium
Etidronic acid disodium (CAS: 7414-83-7) is primarily used in radiopharmaceuticals for medical imaging, such as in the preparation of radiolabeled compounds. It also serves as a stabilizer in pharmaceutical formulations and is employed in industrial processes involving metal ion chelation. Additionally, it finds applications in research for its chelating properties and in the synthesis of other chemical compounds.

About

CAS No 7414-83-7
English Name Etidronic acid disodium
Molecular Formula C2H6Na2O7P2
Molecular Weight 249.99 g/mol
SMILES CC(P(=O)(O)[O-])(P(=O)(O)[O-])O.[Na+].[Na+]
InChIKey GWBBVOVXJZATQQ-UHFFFAOYSA-L
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Etidronic acid disodium (CAS: 7414-83-7)?

Etidronic acid disodium (CAS: 7414-83-7) is a sodium salt of etidronic acid, with the chemical formu...

Compound Q&A

Is Etidronic acid disodium (CAS: 7414-83-7) safe?

Etidronic acid disodium (CAS: 7414-83-7) is generally considered safe when handled according to stan...

Compound Q&A

How should Etidronic acid disodium (CAS: 7414-83-7) be stored?

Etidronic acid disodium (CAS: 7414-83-7) should be stored in a cool, dry place, away from direct lig...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...