Compound Q&A

What are the main uses of 2,3-Dimethyl-2H-indazol-6-amine hydrochloride (1:1) (CAS: 635702-60-2)?

Answer

2,3-Dimethyl-2H-indazol-6-amine hydrochloride (1:1)
2,3-Dimethyl-2H-indazol-6-amine hydrochloride (1:1) is primarily used in pharmaceutical development as a building block for drug synthesis. It may also find applications in medicinal chemistry for the creation of new therapeutic agents. Its chemical structure makes it valuable in research related to biological activity and chemical reactivity.

About

English Name 2,3-Dimethyl-2H-indazol-6-amine hydrochloride (1:1)
Molecular Formula C9H12ClN3
Molecular Weight 197.67 g/mol
SMILES CC1=C2C=CC(=CC2=NN1C)N.Cl
InChIKey DYTQJZDNKWQSLS-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2,3-Dimethyl-2H-indazol-6-amine hydrochloride (1:1) (CAS: 635702-60-2)?

2,3-Dimethyl-2H-indazol-6-amine hydrochloride (1:1) is a chemical compound with the CAS number 63570...

Compound Q&A

Is 2,3-Dimethyl-2H-indazol-6-amine hydrochloride (1:1) (CAS: 635702-60-2) safe?

2,3-Dimethyl-2H-indazol-6-amine hydrochloride (1:1) is generally considered safe when handled proper...

Compound Q&A

How should 2,3-Dimethyl-2H-indazol-6-amine hydrochloride (1:1) (CAS: 635702-60-2) be stored?

2,3-Dimethyl-2H-indazol-6-amine hydrochloride (1:1) should be stored in a cool, dry place away from ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...