Compound Q&A

How should 3,7-Bis(dimethylamino)phenothiazin-5-ium chloride (CAS: 61-73-4) be stored?

Answer

3,7-Bis(dimethylamino)phenothiazin-5-ium chloride
3,7-Bis(dimethylamino)phenothiazin-5-ium chloride (CAS: 61-73-4) should be stored in a cool, dry, and dark place, away from moisture and light. It is best kept in a sealed container made of glass or plastic to maintain stability and prevent degradation.

About

CAS No 61-73-4
English Name 3,7-Bis(dimethylamino)phenothiazin-5-ium chloride
Molecular Formula C16H18ClN3S
Molecular Weight 319.85 g/mol
SMILES CN(C)C1=CC2=[S+]C3=C(C=CC(N(C)C)=C3)N=C2C=C1.[Cl-]
InChIKey CXKWCBBOMKCUKX-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3,7-Bis(dimethylamino)phenothiazin-5-ium chloride (CAS: 61-73-4)?

3,7-Bis(dimethylamino)phenothiazin-5-ium chloride (CAS: 61-73-4) is an organic compound containing a...

Compound Q&A

What are the main uses of 3,7-Bis(dimethylamino)phenothiazin-5-ium chloride (CAS: 61-73-4)?

3,7-Bis(dimethylamino)phenothiazin-5-ium chloride (CAS: 61-73-4) is primarily used in pharmaceutical...

Compound Q&A

Is 3,7-Bis(dimethylamino)phenothiazin-5-ium chloride (CAS: 61-73-4) safe?

3,7-Bis(dimethylamino)phenothiazin-5-ium chloride (CAS: 61-73-4) is generally considered safe when h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...