Compound Q&A

What is N,N,N-Tripropyl-1-propanaminium hydroxide (CAS: 4499-86-9)?

Answer

N,N,N-Tripropyl-1-propanaminium hydroxide
N,N,N-Tripropyl-1-propanaminium hydroxide (CAS: 4499-86-9) is a quaternary ammonium hydroxide compound with the chemical formula C12H27NO. It is characterized by its cationic structure, where a central nitrogen atom is bonded to three propyl groups and a hydroxide ion. This compound is commonly used as a surfactant and exhibits properties such as solubility in water and stability under normal conditions, making it valuable in various chemical applications.

About

CAS No 4499-86-9
English Name N,N,N-Tripropyl-1-propanaminium hydroxide
Molecular Formula C12H29NO
Molecular Weight 203.36 g/mol
SMILES CCC[N+](CCC)(CCC)CCC.[OH-]
InChIKey LPSKDVINWQNWFE-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of N,N,N-Tripropyl-1-propanaminium hydroxide (CAS: 4499-86-9)?

N,N,N-Tripropyl-1-propanaminium hydroxide (CAS: 4499-86-9) is primarily utilized in pharmaceuticals ...

Compound Q&A

Is N,N,N-Tripropyl-1-propanaminium hydroxide (CAS: 4499-86-9) safe?

N,N,N-Tripropyl-1-propanaminium hydroxide (CAS: 4499-86-9) is generally considered safe when handled...

Compound Q&A

How should N,N,N-Tripropyl-1-propanaminium hydroxide (CAS: 4499-86-9) be stored?

N,N,N-Tripropyl-1-propanaminium hydroxide (CAS: 4499-86-9) should be stored in a cool, dry, and dark...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...