Compound Q&A

What are the main uses of 3-Acetoxy-5-[(E)-2-(4-acetoxyphenyl)vinyl]phenyl acetate (CAS: 42206-94-0)?

Answer

3-Acetoxy-5-[(E)-2-(4-acetoxyphenyl)vinyl]phenyl acetate
This compound is primarily used in pharmaceutical research as a potential intermediate in drug synthesis. It also finds applications in organic chemistry for structural studies and in the development of agrochemicals. Its unique chemical structure makes it valuable in creating derivatives with specific biological activities.

About

CAS No 42206-94-0
English Name 3-Acetoxy-5-[(E)-2-(4-acetoxyphenyl)vinyl]phenyl acetate
Molecular Formula C20H18O6
Molecular Weight 354.36 g/mol
SMILES CC(=O)Oc1ccc(cc1)/C=C/c1cc(OC(=O)C)cc(c1)OC(=O)C
InChIKey PDAYUJSOJIMKIS-SNAWJCMRSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3-Acetoxy-5-[(E)-2-(4-acetoxyphenyl)vinyl]phenyl acetate (CAS: 42206-94-0)?

3-Acetoxy-5-[(E)-2-(4-acetoxyphenyl)vinyl]phenyl acetate is a complex organic compound with the CAS ...

Compound Q&A

Is 3-Acetoxy-5-[(E)-2-(4-acetoxyphenyl)vinyl]phenyl acetate (CAS: 42206-94-0) safe?

As a chemical compound, 3-Acetoxy-5-[(E)-2-(4-acetoxyphenyl)vinyl]phenyl acetate is generally consid...

Compound Q&A

How should 3-Acetoxy-5-[(E)-2-(4-acetoxyphenyl)vinyl]phenyl acetate (CAS: 42206-94-0) be stored?

This compound should be stored in a cool, dry, and dark place, ideally at temperatures below 25°C. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...