Compound Q&A

What is 2-Ethylhexyl salicylate (CAS: 118-60-5)?

Answer

2-Ethylhexyl salicylate, with the CAS number 118-60-5, is an ester of salicylic acid and 2-ethylhexanol. It is commonly known as octyl salicylate and is used as a UV absorber in sunscreens. Its chemical formula is C16H26O3, and it is a white crystalline solid with a slightly pungent odor. It is soluble in organic solvents and has a melting point around 60°C.

About

CAS No 118-60-5

English Name 2-Ethylhexyl salicylate

Molecular Formula C15H22O3

Molecular Weight 250.338 g/mol

SMILES CCCCC(CC)COC(=O)c1ccccc1O

InChIKey FMRHJJZUHUTGKE-UHFFFAOYSA-N

Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2-Ethylhexyl salicylate (CAS: 118-60-5)?

2-Ethylhexyl salicylate is primarily used as a sunscreen agent to protect the skin from UV radiation...

Compound Q&A

Is 2-Ethylhexyl salicylate (CAS: 118-60-5) safe?

2-Ethylhexyl salicylate is generally considered safe when used as directed, but it should be handled...

Compound Q&A

How should 2-Ethylhexyl salicylate (CAS: 118-60-5) be stored?

2-Ethylhexyl salicylate should be stored in a cool, dry, and dark place to maintain its stability an...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What is 2-Ethylhexyl salicylate (CAS: 118-60-5)?

Answer

About

Related Q&A

What are the main uses of 2-Ethylhexyl salicylate (CAS: 118-60-5)?

Is 2-Ethylhexyl salicylate (CAS: 118-60-5) safe?

How should 2-Ethylhexyl salicylate (CAS: 118-60-5) be stored?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

ShangHaiMaiRuiErShengHua Technology Co Ltd

ShangHaiYiHe Biotechnology Co Ltd

WuhanDiesel Biotechnology Co., Ltd.

ShenZhenZhenJiangShengWuJiShu Co Ltd

MedChemExpress LLC

Shanghai Analytical Rocky Experimental Technology Co., Ltd.