Compound Q&A

What are the main uses of 4-(Methylamino)-3-nitrobenzoic acid (CAS: 41263-74-5)?

Answer

4-(Methylamino)-3-nitrobenzoic acid
4-(Methylamino)-3-nitrobenzoic acid (CAS: 41263-74-5) is primarily used in pharmaceutical research as a precursor for the synthesis of various drugs and bioactive compounds. It also finds applications in the chemical industry for the production of dyes, agrochemicals, and polymers. Its unique structure makes it valuable for studying chemical reactivity and for developing new materials in research settings.

About

CAS No 41263-74-5
English Name 4-(Methylamino)-3-nitrobenzoic acid
Molecular Formula C8H8N2O4
Molecular Weight 196.16 g/mol
SMILES CNC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-]
InChIKey KSMLIIWEQBYUKA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 4-(Methylamino)-3-nitrobenzoic acid (CAS: 41263-74-5)?

4-(Methylamino)-3-nitrobenzoic acid (CAS: 41263-74-5) is an organic compound with the chemical formu...

Compound Q&A

Is 4-(Methylamino)-3-nitrobenzoic acid (CAS: 41263-74-5) safe?

4-(Methylamino)-3-nitrobenzoic acid (CAS: 41263-74-5) is generally considered safe when handled prop...

Compound Q&A

How should 4-(Methylamino)-3-nitrobenzoic acid (CAS: 41263-74-5) be stored?

4-(Methylamino)-3-nitrobenzoic acid (CAS: 41263-74-5) should be stored in a cool, dry, and dark plac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...