Compound Q&A

What is 4-(Dihydroxyboryl)benzoic acid (CAS: 14047-29-1)?

Answer

4-(Dihydroxyboryl)benzoic acid
4-(Dihydroxyboryl)benzoic acid, with the CAS number 14047-29-1, is an organic compound characterized by a benzoic acid group attached to a boryl substituent. It has the chemical formula C8H10BO4 and is known for its stability and reactivity in various chemical processes. This compound is often used in synthetic chemistry due to its ability to participate in boron-based reactions.

About

CAS No 14047-29-1
English Name 4-(Dihydroxyboryl)benzoic acid
Molecular Formula C7H7BO4
Molecular Weight 165.94 g/mol
SMILES B(C1=CC=C(C=C1)C(=O)O)(O)O
InChIKey SIAVMDKGVRXFAX-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 4-(Dihydroxyboryl)benzoic acid (CAS: 14047-29-1)?

4-(Dihydroxyboryl)benzoic acid (CAS: 14047-29-1) is primarily used in pharmaceutical research for th...

Compound Q&A

Is 4-(Dihydroxyboryl)benzoic acid (CAS: 14047-29-1) safe?

4-(Dihydroxyboryl)benzoic acid (CAS: 14047-29-1) is generally considered safe when handled properly....

Compound Q&A

How should 4-(Dihydroxyboryl)benzoic acid (CAS: 14047-29-1) be stored?

4-(Dihydroxyboryl)benzoic acid (CAS: 14047-29-1) should be stored in a cool, dry, and well-ventilate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...