Compound Q&A

What is 2-[(2-carboxyphenyl)disulfanyl]benzoic acid (CAS: 119-80-2)?

Answer

2-[(2-carboxyphenyl)disulfanyl]benzoic acid
2-[(2-carboxyphenyl)disulfanyl]benzoic acid (CAS: 119-80-2) is an organic compound containing a disulfide bridge between two aromatic rings. Its chemical formula is C14H12O4S2, and it exhibits moderate solubility in polar solvents. The compound is known for its structural complexity and is commonly used in chemical synthesis and research due to its unique functional groups, including carboxylic acid and disulfide linkages.

About

CAS No 119-80-2
English Name 2-[(2-carboxyphenyl)disulfanyl]benzoic acid
Molecular Formula C14H10O4S2
Molecular Weight 306.36 g/mol
SMILES C1=CC=C(C(=C1)C(=O)O)SSC2=CC=CC=C2C(=O)O
InChIKey LBEMXJWGHIEXRA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2-[(2-carboxyphenyl)disulfanyl]benzoic acid (CAS: 119-80-2)?

2-[(2-carboxyphenyl)disulfanyl]benzoic acid (CAS: 119-80-2) is primarily used in pharmaceutical rese...

Compound Q&A

Is 2-[(2-carboxyphenyl)disulfanyl]benzoic acid (CAS: 119-80-2) safe?

2-[(2-carboxyphenyl)disulfanyl]benzoic acid (CAS: 119-80-2) is generally considered safe when handle...

Compound Q&A

How should 2-[(2-carboxyphenyl)disulfanyl]benzoic acid (CAS: 119-80-2) be stored?

2-[(2-carboxyphenyl)disulfanyl]benzoic acid (CAS: 119-80-2) should be stored in a cool, dry, and dar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...