Compound Q&A

What are the main uses of 2-Naphthylboronic acid (CAS: 32316-92-0)?

Answer

2-Naphthylboronic acid
2-Naphthylboronic acid is primarily used in pharmaceutical research for drug development, particularly in the synthesis of boronic esters and as a coupling agent in Suzuki reactions. It also finds applications in organic chemistry as a reagent and in industrial processes for creating various boron-containing compounds. Its unique structure makes it valuable in research related to biochemistry and materials science.

About

CAS No 32316-92-0
English Name 2-Naphthylboronic acid
Molecular Formula C10H9BO2
Molecular Weight 171.992 g/mol
SMILES B(C1=CC2=CC=CC=C2C=C1)(O)O
InChIKey KPTRDYONBVUWPD-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-Naphthylboronic acid (CAS: 32316-92-0)?

2-Naphthylboronic acid is a chemical compound with the CAS number 32316-92-0. It has the molecular f...

Compound Q&A

Is 2-Naphthylboronic acid (CAS: 32316-92-0) safe?

2-Naphthylboronic acid is generally considered safe when handled properly, but it should be treated ...

Compound Q&A

How should 2-Naphthylboronic acid (CAS: 32316-92-0) be stored?

2-Naphthylboronic acid should be stored in a cool, dry, and dark place, ideally at 2-8°C. It is best...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...