Compound Q&A

What are the main uses of 2-Naphthylboronic acid (CAS: 32316-92-0)?

Answer

2-Naphthylboronic acid
2-Naphthylboronic acid is primarily used in pharmaceutical research for drug development, particularly in the synthesis of boronic esters and as a coupling agent in Suzuki reactions. It also finds applications in organic chemistry as a reagent and in industrial processes for creating various boron-containing compounds. Its unique structure makes it valuable in research related to biochemistry and materials science.

About

CAS No 32316-92-0
English Name 2-Naphthylboronic acid
Molecular Formula C10H9BO2
Molecular Weight 171.99 g/mol
SMILES B(C1=CC2=CC=CC=C2C=C1)(O)O
InChIKey KPTRDYONBVUWPD-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-Naphthylboronic acid (CAS: 32316-92-0)?

2-Naphthylboronic acid is a chemical compound with the CAS number 32316-92-0. It has the molecular f...

Compound Q&A

Is 2-Naphthylboronic acid (CAS: 32316-92-0) safe?

2-Naphthylboronic acid is generally considered safe when handled properly, but it should be treated ...

Compound Q&A

How should 2-Naphthylboronic acid (CAS: 32316-92-0) be stored?

2-Naphthylboronic acid should be stored in a cool, dry, and dark place, ideally at 2-8°C. It is best...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...