Compound Q&A

What is 2-Methyl-2-propanyl 4-hydroxy-1-piperidinecarboxylate (CAS: 109384-19-2)?

Answer

2-Methyl-2-propanyl 4-hydroxy-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-hydroxy-1-piperidinecarboxylate (CAS: 109384-19-2) is an organic compound containing a piperidine ring with hydroxy and ester functional groups. Its chemical formula is C10H20O3N. It is typically a colorless liquid with moderate solubility in organic solvents and is known for its stability under normal conditions.

About

English Name 2-Methyl-2-propanyl 4-hydroxy-1-piperidinecarboxylate
Molecular Formula C10H19NO3
Molecular Weight 201.27 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)O
InChIKey PWQLFIKTGRINFF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2-Methyl-2-propanyl 4-hydroxy-1-piperidinecarboxylate (CAS: 109384-19-2)?

This compound is primarily used in pharmaceutical research as an intermediate in the synthesis of va...

Compound Q&A

Is 2-Methyl-2-propanyl 4-hydroxy-1-piperidinecarboxylate (CAS: 109384-19-2) safe?

2-Methyl-2-propanyl 4-hydroxy-1-piperidinecarboxylate is generally considered safe when handled prop...

Compound Q&A

How should 2-Methyl-2-propanyl 4-hydroxy-1-piperidinecarboxylate (CAS: 109384-19-19-2) be stored?

To ensure stability, 2-Methyl-2-propanyl 4-hydroxy-1-piperidinecarboxylate should be stored in a coo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...