Compound Q&A

What are the main uses of 3,4-Difluoronitrobenzene (CAS: 369-34-6)?

Answer

3,4-Difluoronitrobenzene
3,4-Difluoronitrobenzene is primarily used in pharmaceutical research as a building block for drug synthesis. It also finds applications in the production of agrochemicals, dyes, and specialty chemicals. Its unique combination of fluorine and nitro groups allows for tailored reactivity, making it valuable in organic chemistry for creating derivatives with specific functional properties.

About

CAS No 369-34-6
English Name 3,4-Difluoronitrobenzene
Molecular Formula C6H3F2NO2
Molecular Weight 159.09 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])F)F
InChIKey RUBQQRMAWLSCCJ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3,4-Difluoronitrobenzene (CAS: 369-34-6)?

3,4-Difluoronitrobenzene is an aromatic organic compound with the chemical formula C6H3F2NO2. It fea...

Compound Q&A

Is 3,4-Difluoronitrobenzene (CAS: 369-34-6) safe?

3,4-Difluoronitrobenzene is classified as hazardous due to its potential toxicity. Prolonged exposur...

Compound Q&A

How should 3,4-Difluoronitrobenzene (CAS: 369-34-6) be stored?

Store 3,4-Difluoronitrobenzene in a tightly sealed, cool (below 25°C), and dry container, away from ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...