Compound Q&A

How should 9-Phenanthrylboronic acid (CAS: 68572-87-2) be stored?

Answer

9-Phenanthrylboronic acid
9-Phenanthrylboronic acid (CAS: 68572-87-2) should be stored in a cool, dry place below 25°C, away from light. Keep it in a sealed container to prevent moisture absorption and degradation. Maintain low humidity to ensure stability, and avoid exposure to air or reactive substances. Store in a chemical storage cabinet for safety and longevity.

About

CAS No 68572-87-2
English Name 9-Phenanthrylboronic acid
Molecular Formula C14H11BO2
Molecular Weight 222.05 g/mol
SMILES B(C1=CC2=CC=CC=C2C3=CC=CC=C13)(O)O
InChIKey JCDAUYWOHOLVMH-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 9-Phenanthrylboronic acid (CAS: 68572-87-2)?

9-Phenanthrylboronic acid (CAS: 68572-87-2) is a boronic acid derivative with the chemical formula C...

Compound Q&A

What are the main uses of 9-Phenanthrylboronic acid (CAS: 68572-87-2)?

9-Phenanthrylboronic acid (CAS: 68572-87-2) is primarily used in pharmaceutical research for drug de...

Compound Q&A

Is 9-Phenanthrylboronic acid (CAS: 68572-87-2) safe?

9-Phenanthrylboronic acid (CAS: 68572-87-2) is generally considered safe when handled properly. Howe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...