Compound Q&A

What is O-Methylisourea hemisulfate (CAS: 52328-05-9)?

Answer

O-Methylisourea hemisulfate
O-Methylisourea hemisulfate (CAS: 52328-05-9) is a chemical compound commonly used in various scientific applications. It has the chemical formula C5H11NO4S and is known for its hygroscopic nature. This compound is typically a white crystalline solid with a tendency to dissolve in water, making it useful in analytical chemistry and pharmaceutical research.

About

CAS No 52328-05-9
English Name O-Methylisourea hemisulfate
Molecular Formula C4H14N4O6S
Molecular Weight 246.25 g/mol
SMILES COC(=N)N.COC(=N)N.OS(=O)(=O)O
InChIKey QSCPQKVWSNUJLJ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of O-Methylisourea hemisulfate (CAS: 52328-05-9)?

O-Methylisourea hemisulfate (CAS: 52328-05-9) is primarily used in pharmaceuticals as a reagent for ...

Compound Q&A

Is O-Methylisourea hemisulfate (CAS: 52328-05-9) safe?

O-Methylisourea hemisulfate (CAS: 52328-05-9) should be handled with care due to its potential irrit...

Compound Q&A

How should O-Methylisourea hemisulfate (CAS: 52328-05-9) be stored?

O-Methylisourea hemisulfate (CAS: 52328-05-9) should be stored in a cool, dry, and dark place to mai...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...