Compound Q&A

What is [2',6'-bis(propan-2-yloxy)-[1,1'-biphenyl]-3-yl]dicyclohexylphosphane (CAS: 787618-22-8)?

Answer

[2',6'-bis(propan-2-yloxy)-[1,1'-biphenyl]-3-yl]dicyclohexylphosphane
This compound, with the CAS number 787618-22-8, is a phosphane derivative featuring a biphenyl core substituted with propan-2-yloxy groups at the 2' and 6' positions, and dicyclohexyl groups attached to the phosphorus atom. It is typically a colorless to pale yellow liquid with low volatility and is used in various chemical applications due to its unique reactivity and stability properties.

About

English Name [2',6'-bis(propan-2-yloxy)-[1,1'-biphenyl]-3-yl]dicyclohexylphosphane
Molecular Formula C30H43O2P
Molecular Weight 466.65 g/mol
SMILES CC(C)OC1=C(C(=CC=C1)OC(C)C)C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4
InChIKey MXFYYFVVIIWKFE-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of [2',6'-bis(propan-2-yloxy)-[1,1'-biphenyl]-3-yl]dicyclohexylphosphane (CAS: 787618-22-8)?

This compound is primarily used as a coupling agent in pharmaceutical synthesis, particularly in the...

Compound Q&A

Is [2',6'-bis(propan-2-yloxy)-[1,1'-biphenyl]-3-yl]dicyclohexylphosphane (CAS: 787618-22-8) safe?

While generally considered safe in controlled environments, [2',6'-bis(propan-2-yloxy)-[1,1'-bipheny...

Compound Q&A

How should [2',6'-bis(propan-2-yloxy)-[1,1'-biphenyl]-3-yl]dicyclohexylphosphane (CAS: 787618-22-8) be stored?

This compound should be stored in a tightly sealed container in a cool, dry, and well-ventilated are...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...