Compound Q&A

What are the main uses of N-(4-Chlorophenyl)-N'-(3,4-dichlorophenyl)carbamimidic acid (CAS: 101-20-2)?

Answer

N-(4-Chlorophenyl)-N'-(3,4-dichlorophenyl)carbamimidic acid
The primary applications of N-(4-Chlorophenyl)-N'-(3,4-dichlorophenyl)carbamimidic acid (CAS: 101-20-2) include pharmaceutical research, where it serves as a building block for drug development. It is also utilized in industrial chemistry for producing agrochemicals and specialty chemicals. Additionally, it finds relevance in organic synthesis and chemical research for creating complex molecules with specific functional groups.

About

CAS No 101-20-2
English Name N-(4-Chlorophenyl)-N'-(3,4-dichlorophenyl)carbamimidic acid
Molecular Formula C13H9Cl3N2O
Molecular Weight 315.59 g/mol
SMILES Clc1ccc(NC(=O)Nc2ccc(Cl)c(Cl)c2)cc1
InChIKey ICUTUKXCWQYESQ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is N-(4-Chlorophenyl)-N'-(3,4-dichlorophenyl)carbamimidic acid (CAS: 101-20-2)?

N-(4-Chlorophenyl)-N'-(3,4-dichlorophenyl)carbamimidic acid (CAS: 101-20-2) is a chemical compound w...

Compound Q&A

Is N-(4-Chlorophenyl)-N'-(3,4-dichlorophenyl)carbamimidic acid (CAS: 101-20-2) safe?

N-(4-Chlorophenyl)-N'-(3,4-dichlorophenyl)carbamimidic acid (CAS: 101-20-2) requires careful handlin...

Compound Q&A

How should N-(4-Chlorophenyl)-N'-(3,4-dichlorophenyl)carbamimidic acid (CAS: 101-20-2) be stored?

N-(4-Chlorophenyl)-N'-(3,4-dichlorophenyl)carbamimidic acid (CAS: 101-20-2) should be stored in a co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...