Compound Q&A

What is 1,1'-(2,2-Propanediyl)bis[3,5-dibromo-4-(2,3-dibromopropoxy)benzene] (CAS: 21850-44-2)?

Answer

1,1'-(2,2-Propanediyl)bis[3,5-dibromo-4-(2,3-dibromopropoxy)benzene]
1,1'-(2,2-Propanediyl)bis[3,5-dibromo-4-(2,3-dibromopropoxy)benzene] (CAS: 21850-44-2) is a brominated aromatic compound with a complex structure. It contains two bromo-substituted benzene rings connected by a propanediyl bridge, each bearing a 2,3-dibromopropoxy group. This compound is known for its chemical stability and is often used in specialized chemical applications.

About

CAS No 21850-44-2
English Name 1,1'-(2,2-Propanediyl)bis[3,5-dibromo-4-(2,3-dibromopropoxy)benzene]
Molecular Formula C21H20Br8O2
Molecular Weight 943.62 g/mol
SMILES BrCC(COc1c(Br)cc(cc1Br)C(c1cc(Br)c(c(c1)Br)OCC(CBr)Br)(C)C)Br
InChIKey LXIZRZRTWSDLKK-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 1,1'-(2,2-Propanediyl)bis[3,5-dibromo-4-(2,3-dibromopropoxy)benzene] (CAS: 21850-44-2)?

This compound is primarily used in the synthesis of pharmaceutical intermediates and specialty chemi...

Compound Q&A

Is 1,1'-(2,2-Propanediyl)bis[3,5-dibromo-4-(2,3-dibromopropoxy)benzene] (CAS: 21850-44-2) safe?

Safety of 1,1'-(2,2-Propanediyl)bis[3,5-dibromo-4-(2,3-dibromopropoxy)benzene] (CAS: 21850-44-2) dep...

Compound Q&A

How should 1,1'-(2,2-Propanediyl)bis[3,5-dibromo-4-(2,3-dibromopropoxy)benzene] (CAS: 21850-44-2) be stored?

1,1'-(2,2-Propanediyl)bis[3,5-dibromo-4-(2,3-dibromopropoxy)benzene] (CAS: 21850-44-2) should be sto...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...