Compound Q&A

What is Butyl(triphenyl)phosphonium bromide (CAS: 1779-51-7)?

Answer

Butyl(triphenyl)phosphonium bromide
Butyl(triphenyl)phosphonium bromide (CAS: 1779-51-7) is an organophosphorus compound commonly used in chemical synthesis. It has the chemical formula C23H25BrOP and is characterized by its phosphonium bromide functionality and aromatic structure. This compound is typically a yellow solid with moderate solubility in organic solvents and is known for its reactivity in various organic reactions.

About

CAS No 1779-51-7
English Name Butyl(triphenyl)phosphonium bromide
Molecular Formula C22H24BrP
Molecular Weight 399.3 g/mol
SMILES CCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]
InChIKey IKWKJIWDLVYZIY-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Butyl(triphenyl)phosphonium bromide (CAS: 1779-51-7)?

Butyl(triphenyl)phosphonium bromide (CAS: 1779-51-7) is widely used in pharmaceutical research as a ...

Compound Q&A

Is Butyl(triphenyl)phosphonium bromide (CAS: 1779-51-7) safe?

Butyl(triphenyl)phosphonium bromide (CAS: 1779-51-7) is considered hazardous due to its potential to...

Compound Q&A

How should Butyl(triphenyl)phosphonium bromide (CAS: 1779-51-7) be stored?

Butyl(triphenyl)phosphonium bromide (CAS: 1779-51-7) should be stored in a cool, dry, and dark place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...