Compound Q&A

What are the main uses of 1-[(7S)-3,4-Dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl]-N-methylmethanamine hydrochloride (1:1) (CAS: 866783-13-3)?

Answer

1-[(7S)-3,4-Dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl]-N-methylmethanamine hydrochloride (1:1)
This compound is primarily used in pharmaceutical research for its potential as a bioactive molecule. It may serve as a precursor in drug synthesis or as a tool compound for studying molecular interactions. Its unique structure also makes it applicable in organic chemistry for developing new compounds and in medicinal chemistry for exploring therapeutic properties.

About

English Name 1-[(7S)-3,4-Dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl]-N-methylmethanamine hydrochloride (1:1)
Molecular Formula C12H18ClNO2
Molecular Weight 243.73 g/mol
SMILES CNC[C@H]1Cc2c1cc(c(c2)OC)OC.Cl
InChIKey SWSAIQSQSDOONK-SBSPUUFOSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 1-[(7S)-3,4-Dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl]-N-methylmethanamine hydrochloride (1:1) (CAS: 866783-13-3)?

1-[(7S)-3,4-Dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl]-N-methylmethanamine hydrochloride (1:1) is...

Compound Q&A

Is 1-[(7S)-3,4-Dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl]-N-methylmethanamine hydrochloride (1:1) (CAS: 866783-13-3) safe?

The safety of 1-[(7S)-3,4-Dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl]-N-methylmethanamine hydrochl...

Compound Q&A

How should 1-[(7S)-3,4-Dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl]-N-methylmethanamine hydrochloride (1:1) (CAS: 866783-13-3) be stored?

This compound should be stored in a cool, dry, and light-protected environment, ideally at 2-8°C. It...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...