Compound Q&A

What is calcium bis((2R,3S)-2,3,4-trihydroxybutanoate) (CAS: 70753-61-6)?

Answer

calcium bis((2R,3S)-2,3,4-trihydroxybutanoate)
Calcium bis((2R,3S)-2,3,4-trihydroxybutanoate) (CAS: 70753-61-6) is a calcium salt with a molecular formula of Ca(C4H8O7)2. It features stereochemistry at the 2R,3S configuration and contains three hydroxyl groups on the butanoate chain, making it highly soluble in water. This compound is known for its chelating properties and is used in various chemical applications requiring calcium coordination.

About

CAS No 70753-61-6
English Name calcium bis((2R,3S)-2,3,4-trihydroxybutanoate)
Molecular Formula C8H14CaO10
Molecular Weight 310.27 g/mol
SMILES C(C(C(C(=O)[O-])O)O)O.C(C(C(C(=O)[O-])O)O)O.[Ca+2]
InChIKey ZJXGOFZGZFVRHK-BALCVSAKSA-L
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of calcium bis((2R,3S)-2,3,4-trihydroxybutanoate) (CAS: 70753-61-6)?

Calcium bis((2R,3S)-2,3,4-trihydroxybutanoate) (CAS: 70753-61-6) is primarily used in pharmaceutical...

Compound Q&A

Is calcium bis((2R,3S)-2,3,4-trihydroxybutanoate) (CAS: 70753-61-6) safe?

Calcium bis((2R,3S)-2,3,4-trihydroxybutanoate) (CAS: 70753-61-6) is generally considered safe when h...

Compound Q&A

How should calcium bis((2R,3S)-2,3,4-trihydroxybutanoate) (CAS: 70753-61-6) be stored?

Calcium bis((2R,3S)-2,3,4-trihydroxybutanoate) (CAS: 70753-61-6) should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...