Compound Q&A

Is 3-(4-Hydroxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 40246-10-4) safe?

Answer

3-(4-Hydroxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
The safety of 3-(4-Hydroxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 40246-10-4) depends on handling conditions. While it is generally considered non-toxic in controlled environments, standard safety precautions apply, such as wearing protective gloves and eye wear. Proper ventilation and adherence to OSHA guidelines are recommended. Always consult safety data sheets (SDS) for specific risk assessments.

About

CAS No 40246-10-4
English Name 3-(4-Hydroxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
Molecular Formula C22H22O10
Molecular Weight 446.41 g/mol
SMILES COC1=C(C=C2C(=C1)C(=O)C(=CO2)C3=CC=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O
InChIKey OZBAVEKZGSOMOJ-MIUGBVLSSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3-(4-Hydroxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 40246-10-4)?

3-(4-Hydroxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 40246-10-4) is a gl...

Compound Q&A

What are the main uses of 3-(4-Hydroxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 40246-10-4)?

This compound is primarily used in pharmaceutical research for its potential anti-inflammatory and a...

Compound Q&A

How should 3-(4-Hydroxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 40246-10-4) be stored?

Store 3-(4-Hydroxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 40246-10-4) i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...