Compound Q&A

What are the main uses of 4-Bromo-2-nitroaniline (CAS: 875-51-4)?

Answer

4-Bromo-2-nitroaniline
4-Bromo-2-nitroaniline (CAS: 875-51-4) is primarily utilized in pharmaceutical research for synthesizing drugs and agrochemicals. It also finds applications in dye manufacturing and organic chemistry as a building block for functionalized compounds. Its unique combination of bromo and nitro groups makes it valuable in developing new materials and chemical derivatives with specific properties.

About

CAS No 875-51-4
English Name 4-Bromo-2-nitroaniline
Molecular Formula C6H5BrN2O2
Molecular Weight 217.02 g/mol
SMILES Nc1ccc(Br)cc1[N+](=O)[O-]
InChIKey ZCWBZRBJSPWUPG-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 4-Bromo-2-nitroaniline (CAS: 875-51-4)?

4-Bromo-2-nitroaniline (CAS: 875-51-4) is an organic compound with the chemical formula C6H5BrNO2. I...

Compound Q&A

Is 4-Bromo-2-nitroaniline (CAS: 875-51-4) safe?

4-Bromo-2-nitroaniline (CAS: 875-51-4) requires careful handling due to its potential toxicity. It m...

Compound Q&A

How should 4-Bromo-2-nitroaniline (CAS: 875-51-4) be stored?

4-Bromo-2-nitroaniline (CAS: 875-51-4) should be stored in a cool, dry, and well-ventilated area, aw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...