Compound Q&A

What is 2-Phosphono-1,2,4-butanetricarboxylic acid (CAS: 37971-36-1)?

Answer

2-Phosphono-1,2,4-butanetricarboxylic acid
2-Phosphono-1,2,4-butanetricarboxylic acid (CAS: 37971-36-1) is a synthetic organic compound with the chemical formula C5H10O7P. It contains three carboxylic acid groups and a phosphono group attached to a butane backbone. This compound is typically a white crystalline solid, highly soluble in water, and exhibits acidic properties due to its multiple functional groups. It is commonly used as a precursor in chemical synthesis and research applications.

About

CAS No 37971-36-1
English Name 2-Phosphono-1,2,4-butanetricarboxylic acid
Molecular Formula C7H11O9P
Molecular Weight 270.13 g/mol
SMILES OC(=O)CCC(P(=O)(O)O)(C(=O)O)CC(=O)O
InChIKey SZHQPBJEOCHCKM-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2-Phosphono-1,2,4-butanetricarboxylic acid (CAS: 37971-36-1)?

2-Phosphono-1,2,4-butanetricarboxylic acid (CAS: 37971-36-1) is primarily used in pharmaceutical res...

Compound Q&A

Is 2-Phosphono-1,2,4-butanetricarboxylic acid (CAS: 37971-36-1) safe?

2-Phosphono-1,2,4-butanetricarboxylic acid (CAS: 37971-36-1) is generally considered safe when handl...

Compound Q&A

How should 2-Phosphono-1,2,4-butanetricarboxylic acid (CAS: 37971-36-1) be stored?

2-Phosphono-1,2,4-butanetricarboxylic acid (CAS: 37971-36-1) should be stored in a sealed, airtight ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...