Compound Q&A

What is Stachydrine hydrochloride (CAS: 4136-37-2)?

Answer

Stachydrine hydrochloride
Stachydrine hydrochloride (CAS: 4136-37-2) is a chemical compound commonly used in the pharmaceutical industry. It has the chemical formula C10H14N2O2·HCl and is known for its hygroscopic and crystalline properties. This compound is often utilized as an intermediate in the synthesis of various medicinal products and has a molecular weight of approximately 248.69 g/mol.

About

CAS No 4136-37-2
English Name Stachydrine hydrochloride
Molecular Formula C7H14ClNO2
Molecular Weight 179.64 g/mol
SMILES C[N+]1(CCCC1C(=O)O)C.[Cl-]
InChIKey DUNMULOWUUIQIL-RGMNGODLSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Stachydrine hydrochloride (CAS: 4136-37-2)?

Stachydrine hydrochloride (CAS: 4136-37-2) is primarily used in pharmaceuticals as a precursor for t...

Compound Q&A

Is Stachydrine hydrochloride (CAS: 4136-37-2) safe?

Stachydrine hydrochloride (CAS: 4136-37-2) is generally considered safe when handled properly, but i...

Compound Q&A

How should Stachydrine hydrochloride (CAS: 4136-37-2) be stored?

Stachydrine hydrochloride (CAS: 4136-37-2) should be stored in a cool, dry, and well-ventilated area...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...