Compound Q&A

What are the main uses of 7-Chloro-2-methylquinoline (CAS: 4965-33-7)?

Answer

7-Chloro-2-methylquinoline
7-Chloro-2-methylquinoline is primarily used in pharmaceutical research as a building block for drug synthesis. It also finds applications in the production of agrochemicals and dyes. Additionally, it is utilized in organic chemistry for the development of various derivatives and compounds. Due to its unique chemical structure, it is a valuable intermediate in the synthesis of bioactive molecules and has potential uses in medicinal chemistry and material science.

About

CAS No 4965-33-7
English Name 7-Chloro-2-methylquinoline
Molecular Formula C10H8ClN
Molecular Weight 177.63 g/mol
SMILES CC1=NC2=C(C=C1)C=CC(=C2)Cl
InChIKey WQZQFYRSYLXBGP-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 7-Chloro-2-methylquinoline (CAS: 4965-33-7)?

7-Chloro-2-methylquinoline is an organic compound with the chemical formula C10H7ClN. It is a substi...

Compound Q&A

Is 7-Chloro-2-methylquinoline (CAS: 4965-33-7) safe?

7-Chloro-2-methylquinoline is considered toxic if inhaled or ingested, and it may cause irritation t...

Compound Q&A

How should 7-Chloro-2-methylquinoline (CAS: 4965-33-7) be stored?

7-Chloro-2-methylquinoline should be stored in a cool, dry place away from light. It is best kept in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...