Compound Q&A

What is Cyano(4-fluoro-3-phenoxyphenyl)methyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate (CAS: 68359-37-5)?

Answer

Cyano(4-fluoro-3-phenoxyphenyl)methyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate
Cyano(4-fluoro-3-phenoxyphenyl)methyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate is a synthetic organic compound with the CAS number 68359-37-5. It contains a cyano group, a phenoxyphenyl ring, and a cyclopropane structure. This compound is known for its complex molecular architecture and is often used in specialized chemical research and pharmaceutical development due to its potential reactivity and biological activity.

About

CAS No 68359-37-5
English Name Cyano(4-fluoro-3-phenoxyphenyl)methyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate
Molecular Formula C22H18Cl2FNO3
Molecular Weight 434.29 g/mol
SMILES O=C(C1C(C)(C)C1/C=C(Cl)\Cl)OC(C#N)C2=CC=C(F)C(OC3=CC=CC=C3)=C2
InChIKey QQODLKZGRKWIFG-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Cyano(4-fluoro-3-phenoxyphenyl)methyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate (CAS: 68359-37-5)?

This compound is primarily used in pharmaceutical research as a potential intermediate in the synthe...

Compound Q&A

Is Cyano(4-fluoro-3-phenoxyphenyl)methyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate (CAS: 68359-37-5) safe?

The safety of Cyano(4-fluoro-3-phenoxyphenyl)methyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropaneca...

Compound Q&A

How should Cyano(4-fluoro-3-phenoxyphenyl)methyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate (CAS: 68359-37-5) be stored?

This compound should be stored in a cool, dry, and well-ventilated place, away from light and moistu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...