Compound Q&A

What is (R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-benzo[d]azepine hydrochloride (CAS: 846589-98-8)?

Answer

(R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-benzo[d]azepine hydrochloride
This compound is a chlorinated derivative of benzo[d]azepine, specifically (R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-benzo[d]azepine hydrochloride. It has the molecular formula C11H15Cl2N and is known for its structural features that make it relevant in medicinal chemistry. The compound is a white to off-white solid, commonly used in pharmaceutical research due to its potential biological activity.

About

English Name (R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-benzo[d]azepine hydrochloride
Molecular Formula C11H15Cl2N
Molecular Weight 232.15 g/mol
SMILES C[C@H]1CNCCC2=CC=C(Cl)C=C12.Cl
InChIKey ITIHHRMYZPNGRC-QRPNPIFTSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-benzo[d]azepine hydrochloride (CAS: 846589-98-8)?

The compound is primarily used in pharmaceutical research as a potential lead molecule for drug deve...

Compound Q&A

Is (R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-benzo[d]azepine hydrochloride (CAS: 846589-98-8) safe?

Safety of this compound depends on its handling and application. It is generally considered safe whe...

Compound Q&A

How should (R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-benzo[d]azepine hydrochloride (CAS: 846589-98-8) be stored?

This compound should be stored in a cool, dry, and dark place, away from moisture and light. It is t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...